CAS 1000304-40-4 appears in our catalog under these names: (1S,2S,5R,6S,7S)-6,8,8-Trimethyl-3-azatricyclo[5.1.1.0(2,5)]nonan-4-one, 95%, (1S,2S,5R,6S,7S)-6,8,8-Trimethyl-3-azatricyclo(5.1.1.02,5)nonan-4-one, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 250mg, 1g.
(1S,2S,5R,6S,7S)-6,8,8-trimethyl-3-azatricyclo[5.1.1.02,5]nonan-4-one (CAS 1000304-40-4) is a chemical compound with the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. IUPAC name: (1S,2S,5R,6S,7S)-6,8,8-trimethyl-3-azatricyclo[5.1.1.02,5]nonan-4-one. InChIKey: DYJCUNKVHDGMKK-ABXGFROZSA-N.
| Molecular formula | C11H17NO |
|---|---|
| Molecular weight | 179.26 g/mol |
| IUPAC name | (1S,2S,5R,6S,7S)-6,8,8-trimethyl-3-azatricyclo[5.1.1.02,5]nonan-4-one |
| InChIKey | DYJCUNKVHDGMKK-ABXGFROZSA-N |
| SMILES | C[C@H]1[C@@H]2C[C@@H](C2(C)C)[C@H]3[C@@H]1C(=O)N3 |
Computed by PubChem (NCBI)