(R)-2-Phenylmorpholine, 98%
cas: 1225376-02-2 — see every product listed under this CAS number, including other names
(R)-2-Phenylmorpholine, 98% (CAS 1225376-02-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1128FE-100mg |
| cas | 1225376-02-2 |
| size | 100mg |
| availability | 250g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 500mg | 232.40 Pln | |
| Chemat | 1g | 309.20 Pln | |
| Chemat | 5g | 1096.40 Pln | |
| Chemat | 10g | 1994.00 Pln | |
| Chemat | 50g | 5517.20 Pln | |
| Chemat | 100g | 10019.60 Pln | |
| Chemat | 250g | 20358.80 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2R)-2-phenylmorpholine (CAS 1225376-02-2) is a chemical compound with the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. IUPAC name: (2R)-2-phenylmorpholine. InChIKey: ZLNGFYDJXZZFJP-JTQLQIEISA-N.
| Molecular formula | C10H13NO |
|---|---|
| Molecular weight | 163.22 g/mol |
| IUPAC name | (2R)-2-phenylmorpholine |
| InChIKey | ZLNGFYDJXZZFJP-JTQLQIEISA-N |
| SMILES | C1CO[C@@H](CN1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)