CAS 55270-04-7 is the registry number for (Cis-1-amino-indan-2-yl)-methanol, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
[(1R,2R)-1-amino-2,3-dihydro-1H-inden-2-yl]methanol (CAS 55270-04-7) is a chemical compound with the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. IUPAC name: [(1R,2R)-1-amino-2,3-dihydro-1H-inden-2-yl]methanol. InChIKey: NUYCSMIPFIJMQL-WCBMZHEXSA-N.
| Molecular formula | C10H13NO |
|---|---|
| Molecular weight | 163.22 g/mol |
| IUPAC name | [(1R,2R)-1-amino-2,3-dihydro-1H-inden-2-yl]methanol |
| InChIKey | NUYCSMIPFIJMQL-WCBMZHEXSA-N |
| SMILES | C1[C@H]([C@H](C2=CC=CC=C21)N)CO |
Computed by PubChem (NCBI)