cas: 788149-96-2 — see every product listed under this CAS number, including other names
(R)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-(2-bromophenyl)butanoic acid, ≥98%, ≥98% (CAS 788149-96-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116DFT-100mg |
| cas | 788149-96-2 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 654.80 Pln | |
| Chemat | 250mg | 678.80 Pln | |
| Chemat | 1g | 2224.40 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
(3R)-4-(2-bromophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid (CAS 788149-96-2) is a chemical compound with the molecular formula C25H22BrNO4 and a molecular weight of 480.3 g/mol. IUPAC name: (3R)-4-(2-bromophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid. InChIKey: WLVUAXHMNMNOKU-QGZVFWFLSA-N.
| Molecular formula | C25H22BrNO4 |
|---|---|
| Molecular weight | 480.3 g/mol |
| IUPAC name | (3R)-4-(2-bromophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| InChIKey | WLVUAXHMNMNOKU-QGZVFWFLSA-N |
| SMILES | C1=CC=C(C(=C1)C[C@H](CC(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)Br |
Computed by PubChem (NCBI)