CAS 788149-96-2 appears in our catalog under these names: Fmoc-(r)-3-amino-4-(2-bromo-phenyl)-butyric acid, 95%, (R)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-(2-bromophenyl)butanoic acid, ≥98%, ≥98%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 100mg.
(3R)-4-(2-bromophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid (CAS 788149-96-2) is a chemical compound with the molecular formula C25H22BrNO4 and a molecular weight of 480.3 g/mol. IUPAC name: (3R)-4-(2-bromophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid. InChIKey: WLVUAXHMNMNOKU-QGZVFWFLSA-N.
| Molecular formula | C25H22BrNO4 |
|---|---|
| Molecular weight | 480.3 g/mol |
| IUPAC name | (3R)-4-(2-bromophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| InChIKey | WLVUAXHMNMNOKU-QGZVFWFLSA-N |
| SMILES | C1=CC=C(C(=C1)C[C@H](CC(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)Br |
Computed by PubChem (NCBI)