(R)-3-((tert-Butoxycarbonyl)amino)-5-(methylthio)pentanoic acid, 97%, 97%
cas: 244251-20-5 — see every product listed under this CAS number, including other names
(R)-3-((tert-Butoxycarbonyl)amino)-5-(methylthio)pentanoic acid, 97%, 97% (CAS 244251-20-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BCW9-100mg |
| cas | 244251-20-5 |
| size | 100mg |
| availability | 20g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 1g | 318.80 Pln | |
| Chemat | 5g | 1341.20 Pln | |
| Chemat | 10g | 2310.80 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-methylsulfanylpentanoic acid (CAS 244251-20-5) is a chemical compound with the molecular formula C11H21NO4S and a molecular weight of 263.36 g/mol. IUPAC name: (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-methylsulfanylpentanoic acid. InChIKey: HBFKPNZCUUZRLA-QMMMGPOBSA-N.
| Molecular formula | C11H21NO4S |
|---|---|
| Molecular weight | 263.36 g/mol |
| IUPAC name | (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-methylsulfanylpentanoic acid |
| InChIKey | HBFKPNZCUUZRLA-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCSC)CC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(3R)-3-{[(tert-butoxy)carbonyl]amino}-5-(methylsulfanyl)pentanoic acid, (3R)-3-(((tert-butoxy)carbonyl)amino)-5-(methylsulfanyl)pentanoic acid, (R)-3-((tert-Butoxycarbonyl)amino)-5-(methylthio)pentanoic acid, Boc-|A-Homomet-OH, Boc-L-beta-homomethionine, (R)-3-(Boc-amino)-5-(methylthio)pentanoic acid, (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-methylsulfanylpentanoic acid, Pentanoic acid, 3-[[(1,1-dimethylethoxy)carbonyl]amino]-5-(methylthio)-,(3R)-, Boc-|A-homet-oh, Boc-D-beta-homomethionine