cas: 244251-20-5 — see every product listed under this CAS number, including other names
(R)-3-((tert-Butoxycarbonyl)amino)-5-(methylthio)pentanoic acid, 97% (CAS 244251-20-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F241391-250MG |
| cas | 244251-20-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 237.43 Pln | |
| Fluorochem | 1g | 388.42 Pln | |
| Fluorochem | 5g | 1320.39 Pln | |
| Fluorochem | 10g | 2262.76 Pln | |
| Fluorochem | 25g | 5579.30 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-methylsulfanylpentanoic acid (CAS 244251-20-5) is a chemical compound with the molecular formula C11H21NO4S and a molecular weight of 263.36 g/mol. IUPAC name: (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-methylsulfanylpentanoic acid. InChIKey: HBFKPNZCUUZRLA-QMMMGPOBSA-N.
| Molecular formula | C11H21NO4S |
|---|---|
| Molecular weight | 263.36 g/mol |
| IUPAC name | (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-methylsulfanylpentanoic acid |
| InChIKey | HBFKPNZCUUZRLA-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCSC)CC(=O)O |
Computed by PubChem (NCBI)