cas: 430461-56-6 — see every product listed under this CAS number, including other names
(R)-3-Phenylpiperidine, 98%, 98% (CAS 430461-56-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D061-100mg |
| cas | 430461-56-6 |
| size | 100mg |
| availability | 6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 179.60 Pln | |
| Chemat | 250mg | 290.00 Pln | |
| Chemat | 1g | 966.80 Pln | |
| Chemat | 5g | 3290.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3R)-3-phenylpiperidine (CAS 430461-56-6) is a chemical compound with the molecular formula C11H15N and a molecular weight of 161.24 g/mol. IUPAC name: (3R)-3-phenylpiperidine. InChIKey: NZYBILDYPCVNMU-NSHDSACASA-N.
| Molecular formula | C11H15N |
|---|---|
| Molecular weight | 161.24 g/mol |
| IUPAC name | (3R)-3-phenylpiperidine |
| InChIKey | NZYBILDYPCVNMU-NSHDSACASA-N |
| SMILES | C1C[C@@H](CNC1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)