CAS 70665-05-3 appears in our catalog under these names: (S)-2-Phenylpiperidine, 95%, (S)–2–Phenylpiperidine, (S)-2-Phenylpiperidine 98%, (S)-2-Phenylpiperidine, 98%, 98%, (S)-2-PHENYLPIPERIDINE, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
(2S)-2-phenylpiperidine (CAS 70665-05-3) is a chemical compound with the molecular formula C11H15N and a molecular weight of 161.24 g/mol. IUPAC name: (2S)-2-phenylpiperidine. InChIKey: WGIAUTGOUJDVEI-NSHDSACASA-N.
| Molecular formula | C11H15N |
|---|---|
| Molecular weight | 161.24 g/mol |
| IUPAC name | (2S)-2-phenylpiperidine |
| InChIKey | WGIAUTGOUJDVEI-NSHDSACASA-N |
| SMILES | C1CCN[C@@H](C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)