cas: 391248-13-8 — see every product listed under this CAS number, including other names
(R)-4-Aminomethyl-thiazolidine-3-carboxylic acidtert-butyl ester (CAS 391248-13-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F011406-250MG |
| cas | 391248-13-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1299.56 Pln | |
| Fluorochem | 1g | 1945.17 Pln | |
| Fluorochem | 5g | 5751.12 Pln |
| delivery time | 2-3 weeks |
|---|
Tert-butyl (4R)-4-(aminomethyl)-1,3-thiazolidine-3-carboxylate (CAS 391248-13-8) is a chemical compound with the molecular formula C9H18N2O2S and a molecular weight of 218.32 g/mol. IUPAC name: tert-butyl (4R)-4-(aminomethyl)-1,3-thiazolidine-3-carboxylate. InChIKey: XRUIGLRQDKZXKJ-SSDOTTSWSA-N.
| Molecular formula | C9H18N2O2S |
|---|---|
| Molecular weight | 218.32 g/mol |
| IUPAC name | tert-butyl (4R)-4-(aminomethyl)-1,3-thiazolidine-3-carboxylate |
| InChIKey | XRUIGLRQDKZXKJ-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N1CSC[C@H]1CN |
Computed by PubChem (NCBI)