Products 933693-48-2

CAS 933693-48-2 is the registry number for 4-Piperidin-4-yl-thiomorpholine 1,1-dioxide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 10g, 1g.

Structural formula: {0} (CAS {1})

4-piperidin-4-yl-1,4-thiazinane 1,1-dioxide (CAS 933693-48-2) is a chemical compound with the molecular formula C9H18N2O2S and a molecular weight of 218.32 g/mol. IUPAC name: 4-piperidin-4-yl-1,4-thiazinane 1,1-dioxide. InChIKey: ANXTVEAHYVGSTP-UHFFFAOYSA-N.

Identity
Molecular formulaC9H18N2O2S
Molecular weight218.32 g/mol
IUPAC name4-piperidin-4-yl-1,4-thiazinane 1,1-dioxide
InChIKeyANXTVEAHYVGSTP-UHFFFAOYSA-N
SMILESC1CNCCC1N2CCS(=O)(=O)CC2

Computed by PubChem (NCBI)