(R)-4-Benzyl-2-(6-cyclopropylpyridin-2-yl)-4,5-dihydrooxazole, 95%
cas: 2828438-60-2 — see every product listed under this CAS number, including other names
(R)-4-Benzyl-2-(6-cyclopropylpyridin-2-yl)-4,5-dihydrooxazole, 95% (CAS 2828438-60-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1519875-100mg |
| cas | 2828438-60-2 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 398.19 Pln | |
| Ambeed | 250mg | 765.31 Pln | |
| Ambeed | 1g | 2489.69 Pln | |
| Ambeed | 5g | 9743.19 Pln | |
| Chemat | 100mg | 410.00 Pln | |
| Chemat | 250mg | 803.60 Pln | |
| Chemat | 1g | 2397.20 Pln | |
| BLDpharm | 100mg | 425.43 Pln | |
| BLDpharm | 250mg | 819.74 Pln | |
| BLDpharm | 1g | 2424.73 Pln | |
| BLDpharm | 5g | 9494.46 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(4R)-4-benzyl-2-(6-cyclopropyl-2-pyridinyl)-4,5-dihydro-1,3-oxazole (CAS 2828438-60-2) is a chemical compound with the molecular formula C18H18N2O and a molecular weight of 278.3 g/mol. IUPAC name: (4R)-4-benzyl-2-(6-cyclopropyl-2-pyridinyl)-4,5-dihydro-1,3-oxazole. InChIKey: VJKQWPKASQIGHC-OAHLLOKOSA-N.
| Molecular formula | C18H18N2O |
|---|---|
| Molecular weight | 278.3 g/mol |
| IUPAC name | (4R)-4-benzyl-2-(6-cyclopropyl-2-pyridinyl)-4,5-dihydro-1,3-oxazole |
| InChIKey | VJKQWPKASQIGHC-OAHLLOKOSA-N |
| SMILES | C1CC1C2=NC(=CC=C2)C3=N[C@@H](CO3)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)