CAS 955972-07-3 is the registry number for [3-(3,4-Dimethylphenyl)-1-phenyl-1h-pyrazol-4-yl]methanol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 10g, 250mg, 100mg.
[3-(3,4-dimethylphenyl)-1-phenylpyrazol-4-yl]methanol (CAS 955972-07-3) is a chemical compound with the molecular formula C18H18N2O and a molecular weight of 278.3 g/mol. IUPAC name: [3-(3,4-dimethylphenyl)-1-phenylpyrazol-4-yl]methanol. InChIKey: HZIUFCSZDOXXEO-UHFFFAOYSA-N.
| Molecular formula | C18H18N2O |
|---|---|
| Molecular weight | 278.3 g/mol |
| IUPAC name | [3-(3,4-dimethylphenyl)-1-phenylpyrazol-4-yl]methanol |
| InChIKey | HZIUFCSZDOXXEO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=NN(C=C2CO)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)