cas: 1228561-27-0 — see every product listed under this CAS number, including other names
(R)-5-Bromo-2,3-dihydro-1H-inden-1-amine 95% (CAS 1228561-27-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A336417-100mg |
| cas | 1228561-27-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 526.12 Pln | |
| Ambeed | 250mg | 826.50 Pln | |
| Ambeed | 1g | 2361.75 Pln | |
| Ambeed | 5g | 6956.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A336417 |
(1R)-5-bromo-2,3-dihydro-1H-inden-1-amine (CAS 1228561-27-0) is a chemical compound with the molecular formula C9H10BrN and a molecular weight of 212.09 g/mol. IUPAC name: (1R)-5-bromo-2,3-dihydro-1H-inden-1-amine. InChIKey: IEUKCNPRRGOGDG-SECBINFHSA-N.
| Molecular formula | C9H10BrN |
|---|---|
| Molecular weight | 212.09 g/mol |
| IUPAC name | (1R)-5-bromo-2,3-dihydro-1H-inden-1-amine |
| InChIKey | IEUKCNPRRGOGDG-SECBINFHSA-N |
| SMILES | C1CC2=C([C@@H]1N)C=CC(=C2)Br |
Computed by PubChem (NCBI)