cas: 530084-79-8 — see every product listed under this CAS number, including other names
(R)-8-(Benzyloxy)-5-(2-bromo-1-hydroxyethyl)quinolin-2(1H)-one, 97% (CAS 530084-79-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Fluorochem, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F213722-100MG |
| cas | 530084-79-8 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 122.89 Pln | |
| Fluorochem | 250mg | 164.54 Pln | |
| Fluorochem | 1g | 305.12 Pln | |
| Fluorochem | 5g | 981.96 Pln | |
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 194.00 Pln | |
| Chemat | 5g | 592.40 Pln | |
| BLDpharm | 100mg | 131.09 Pln | |
| BLDpharm | 250mg | 164.41 Pln | |
| BLDpharm | 1g | 247.72 Pln | |
| BLDpharm | 5g | 730.88 Pln | |
| BLDpharm | 25g | 2385.85 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
5-[(1R)-2-bromo-1-hydroxyethyl]-8-phenylmethoxy-1H-quinolin-2-one (CAS 530084-79-8) is a chemical compound with the molecular formula C18H16BrNO3 and a molecular weight of 374.2 g/mol. IUPAC name: 5-[(1R)-2-bromo-1-hydroxyethyl]-8-phenylmethoxy-1H-quinolin-2-one. InChIKey: GNFMSZCSSUZAGV-HNNXBMFYSA-N.
| Molecular formula | C18H16BrNO3 |
|---|---|
| Molecular weight | 374.2 g/mol |
| IUPAC name | 5-[(1R)-2-bromo-1-hydroxyethyl]-8-phenylmethoxy-1H-quinolin-2-one |
| InChIKey | GNFMSZCSSUZAGV-HNNXBMFYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C3C(=C(C=C2)[C@H](CBr)O)C=CC(=O)N3 |
Computed by PubChem (NCBI)