CAS 211315-47-8 is the registry number for (R)-4-Benzyl-3-(2-(4-bromophenyl)acetyl)oxazolidin-2-one, 98%. Offered by: Ambeed. Available pack sizes: 100mg, 1g, 5g, 250mg.
(4R)-4-benzyl-3-[2-(4-bromophenyl)acetyl]-1,3-oxazolidin-2-one (CAS 211315-47-8) is a chemical compound with the molecular formula C18H16BrNO3 and a molecular weight of 374.2 g/mol. IUPAC name: (4R)-4-benzyl-3-[2-(4-bromophenyl)acetyl]-1,3-oxazolidin-2-one. InChIKey: UVIMFFKYYGMNBE-MRXNPFEDSA-N.
| Molecular formula | C18H16BrNO3 |
|---|---|
| Molecular weight | 374.2 g/mol |
| IUPAC name | (4R)-4-benzyl-3-[2-(4-bromophenyl)acetyl]-1,3-oxazolidin-2-one |
| InChIKey | UVIMFFKYYGMNBE-MRXNPFEDSA-N |
| SMILES | C1[C@H](N(C(=O)O1)C(=O)CC2=CC=C(C=C2)Br)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)