cas: 1187931-23-2 — see every product listed under this CAS number, including other names
(R)-Benzyl 2-(aminomethyl)pyrrolidine-1-carboxylate 95% (CAS 1187931-23-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A416588-250mg |
| cas | 1187931-23-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 192.38 Pln | |
| Ambeed | 1g | 214.62 Pln | |
| Ambeed | 5g | 409.31 Pln | |
| Ambeed | 10g | 592.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A416588 |
Benzyl (2R)-2-(aminomethyl)pyrrolidine-1-carboxylate (CAS 1187931-23-2) is a chemical compound with the molecular formula C13H18N2O2 and a molecular weight of 234.29 g/mol. IUPAC name: benzyl (2R)-2-(aminomethyl)pyrrolidine-1-carboxylate. InChIKey: NQGRCKNDDGCZPV-GFCCVEGCSA-N.
| Molecular formula | C13H18N2O2 |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | benzyl (2R)-2-(aminomethyl)pyrrolidine-1-carboxylate |
| InChIKey | NQGRCKNDDGCZPV-GFCCVEGCSA-N |
| SMILES | C1C[C@@H](N(C1)C(=O)OCC2=CC=CC=C2)CN |
Computed by PubChem (NCBI)