CAS 2771208-83-2 appears in our catalog under these names: (R)–HTS–3, (R)-HTS-3/ 98.89% (existing batch purity), (R)-HTS-3, (R)-HTS-3, 99.29%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 25mg, 50mg, 100mg, 200mg, 100 mg.
N-[(2R)-2-(dimethylamino)-2-phenylethyl]-3,5-difluorobenzamide (CAS 2771208-83-2) is a chemical compound with the molecular formula C17H18F2N2O and a molecular weight of 304.33 g/mol. IUPAC name: N-[(2R)-2-(dimethylamino)-2-phenylethyl]-3,5-difluorobenzamide. InChIKey: SDNDFXUSMLLOMH-INIZCTEOSA-N.
| Molecular formula | C17H18F2N2O |
|---|---|
| Molecular weight | 304.33 g/mol |
| IUPAC name | N-[(2R)-2-(dimethylamino)-2-phenylethyl]-3,5-difluorobenzamide |
| InChIKey | SDNDFXUSMLLOMH-INIZCTEOSA-N |
| SMILES | CN(C)[C@@H](CNC(=O)C1=CC(=CC(=C1)F)F)C2=CC=CC=C2 |
Computed by PubChem (NCBI)