cas: 1408057-39-5 — see every product listed under this CAS number, including other names
(R)-Methyl 4,4-difluoropyrrolidine-2-carboxylate hydrochloride, 97%, 97% (CAS 1408057-39-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112CSK-100mg |
| cas | 1408057-39-5 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 179.60 Pln | |
| Chemat | 250mg | 222.80 Pln | |
| Chemat | 1g | 525.20 Pln | |
| Chemat | 5g | 1883.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl (2R)-4,4-difluoropyrrolidine-2-carboxylate;hydrochloride (CAS 1408057-39-5) is a chemical compound with the molecular formula C6H10ClF2NO2 and a molecular weight of 201.60 g/mol. IUPAC name: methyl (2R)-4,4-difluoropyrrolidine-2-carboxylate;hydrochloride. InChIKey: XGOHSFOAFOLNFY-PGMHMLKASA-N.
| Molecular formula | C6H10ClF2NO2 |
|---|---|
| Molecular weight | 201.60 g/mol |
| IUPAC name | methyl (2R)-4,4-difluoropyrrolidine-2-carboxylate;hydrochloride |
| InChIKey | XGOHSFOAFOLNFY-PGMHMLKASA-N |
| SMILES | COC(=O)[C@H]1CC(CN1)(F)F.Cl |
Computed by PubChem (NCBI)