CAS 156046-05-8 appears in our catalog under these names: Methyl (S)-4,4-difluoropyrrolidine-2-carboxylate hydrochloride, 95%, (S)–Methyl 4,4–difluoropyrrolidine–2–carboxylate hydrochloride, (S)-Methyl 4,4-difluoropyrrolidine-2-carboxylate hydrochloride, 97%, 97%, (S)-METHYL 4,4-DIFLUOROPYRROLIDINE-2-CARBOXYLATE HCL, 95%, N-4,4-DiF-Pro-OMe·HCl, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 25g, 250mg, 1g, 10g, 100mg.
Methyl (2S)-4,4-difluoropyrrolidine-2-carboxylate;hydrochloride (CAS 156046-05-8) is a chemical compound with the molecular formula C6H10ClF2NO2 and a molecular weight of 201.60 g/mol. IUPAC name: methyl (2S)-4,4-difluoropyrrolidine-2-carboxylate;hydrochloride. InChIKey: XGOHSFOAFOLNFY-WCCKRBBISA-N.
| Molecular formula | C6H10ClF2NO2 |
|---|---|
| Molecular weight | 201.60 g/mol |
| IUPAC name | methyl (2S)-4,4-difluoropyrrolidine-2-carboxylate;hydrochloride |
| InChIKey | XGOHSFOAFOLNFY-WCCKRBBISA-N |
| SMILES | COC(=O)[C@@H]1CC(CN1)(F)F.Cl |
Computed by PubChem (NCBI)