cas: 637027-25-9 — see every product listed under this CAS number, including other names
(R)-Methyl piperazine-2-carboxylate dihydrochloride, 98% (CAS 637027-25-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F210999-100MG |
| cas | 637027-25-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 102.07 Pln | |
| Fluorochem | 250mg | 107.27 Pln | |
| Fluorochem | 1g | 206.20 Pln | |
| Fluorochem | 5g | 685.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl (2R)-piperazine-2-carboxylate;dihydrochloride (CAS 637027-25-9) is a chemical compound with the molecular formula C6H14Cl2N2O2 and a molecular weight of 217.09 g/mol. IUPAC name: methyl (2R)-piperazine-2-carboxylate;dihydrochloride. InChIKey: ZBYFDUSYNDLSND-ZJIMSODOSA-N.
| Molecular formula | C6H14Cl2N2O2 |
|---|---|
| Molecular weight | 217.09 g/mol |
| IUPAC name | methyl (2R)-piperazine-2-carboxylate;dihydrochloride |
| InChIKey | ZBYFDUSYNDLSND-ZJIMSODOSA-N |
| SMILES | COC(=O)[C@H]1CNCCN1.Cl.Cl |
Computed by PubChem (NCBI)