Products 75944-99-9

CAS 75944-99-9 appears in our catalog under these names: 4-Methyl-piperazine-2-carboxylic acid dihydrochloride, 95%, 4-Methylpiperazine-2-carboxylic acid dihydrochloride, 96%, 4-Methyl-piperazine-2-carboxylic acid diHCl, 95%, 95%, 4-Methylpiperazine-2-carboxylic acid dihydrochloride, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

4-methylpiperazine-2-carboxylic acid;dihydrochloride (CAS 75944-99-9) is a chemical compound with the molecular formula C6H14Cl2N2O2 and a molecular weight of 217.09 g/mol. IUPAC name: 4-methylpiperazine-2-carboxylic acid;dihydrochloride. InChIKey: NXIVGAYIUBHNQC-UHFFFAOYSA-N.

Identity
Molecular formulaC6H14Cl2N2O2
Molecular weight217.09 g/mol
IUPAC name4-methylpiperazine-2-carboxylic acid;dihydrochloride
InChIKeyNXIVGAYIUBHNQC-UHFFFAOYSA-N
SMILESCN1CCNC(C1)C(=O)O.Cl.Cl

Computed by PubChem (NCBI)