cas: 620627-46-5 — see every product listed under this CAS number, including other names
(R)-N-(2-Hydroxy-2-methyl-1-phenylpropyl)-4-methylbenzenesulfonamide, 95%, 95% (CAS 620627-46-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EAPE-1g |
| cas | 620627-46-5 |
| size | 1g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 309.20 Pln | |
| Chemat | 5g | 1048.40 Pln | |
| Chemat | 10g | 1994.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-[(1R)-2-hydroxy-2-methyl-1-phenylpropyl]-4-methylbenzenesulfonamide (CAS 620627-46-5) is a chemical compound with the molecular formula C17H21NO3S and a molecular weight of 319.4 g/mol. IUPAC name: N-[(1R)-2-hydroxy-2-methyl-1-phenylpropyl]-4-methylbenzenesulfonamide. InChIKey: ZTVQXNICBNVQJO-MRXNPFEDSA-N.
| Molecular formula | C17H21NO3S |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | N-[(1R)-2-hydroxy-2-methyl-1-phenylpropyl]-4-methylbenzenesulfonamide |
| InChIKey | ZTVQXNICBNVQJO-MRXNPFEDSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N[C@H](C2=CC=CC=C2)C(C)(C)O |
Computed by PubChem (NCBI)