Products 866051-54-9
CAS 866051-54-9 is the registry number for 4,6-Dimethyl-3-(2-methylphenyl)sulfonyl-1-propan-2-ylpyridin-2-one. Offered by: Biosynth. Available pack sizes: 25mg, 50mg, 100mg.
4,6-dimethyl-3-(2-methylphenyl)sulfonyl-1-propan-2-ylpyridin-2-one (CAS 866051-54-9) is a chemical compound with the molecular formula C17H21NO3S and a molecular weight of 319.4 g/mol. IUPAC name: 4,6-dimethyl-3-(2-methylphenyl)sulfonyl-1-propan-2-ylpyridin-2-one. InChIKey: VMBQNRFBFZYWDC-UHFFFAOYSA-N.
| Molecular formula | C17H21NO3S |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | 4,6-dimethyl-3-(2-methylphenyl)sulfonyl-1-propan-2-ylpyridin-2-one |
| InChIKey | VMBQNRFBFZYWDC-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1S(=O)(=O)C2=C(C=C(N(C2=O)C(C)C)C)C |
Computed by PubChem (NCBI)