cas: 954388-33-1 — see every product listed under this CAS number, including other names
(R)-N-4-Boc-N-1-Cbz-2-piperazine carboxylic acid, 97% (CAS 954388-33-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F041334-100MG |
| cas | 954388-33-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 216.61 Pln | |
| Fluorochem | 250mg | 294.71 Pln | |
| Fluorochem | 1g | 732.05 Pln | |
| Fluorochem | 5g | 2663.66 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(2R)-4-[(2-methylpropan-2-yl)oxycarbonyl]-1-phenylmethoxycarbonylpiperazine-2-carboxylic acid (CAS 954388-33-1) is a chemical compound with the molecular formula C18H24N2O6 and a molecular weight of 364.4 g/mol. IUPAC name: (2R)-4-[(2-methylpropan-2-yl)oxycarbonyl]-1-phenylmethoxycarbonylpiperazine-2-carboxylic acid. InChIKey: MKXMXZZARNRMMQ-CQSZACIVSA-N.
| Molecular formula | C18H24N2O6 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | (2R)-4-[(2-methylpropan-2-yl)oxycarbonyl]-1-phenylmethoxycarbonylpiperazine-2-carboxylic acid |
| InChIKey | MKXMXZZARNRMMQ-CQSZACIVSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN([C@H](C1)C(=O)O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)