cas: 313490-25-4 — see every product listed under this CAS number, including other names
N-Boc-(2'-Chlorophenyl)glycine, 98% (CAS 313490-25-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F011506-250MG |
| cas | 313490-25-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 133.30 Pln | |
| Fluorochem | 1g | 143.72 Pln | |
| Fluorochem | 5g | 497.76 Pln | |
| Fluorochem | 10g | 935.11 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-(2-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 313490-25-4) is a chemical compound with the molecular formula C13H16ClNO4 and a molecular weight of 285.72 g/mol. IUPAC name: 2-(2-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: XPFJZGJBRMTXCE-UHFFFAOYSA-N.
| Molecular formula | C13H16ClNO4 |
|---|---|
| Molecular weight | 285.72 g/mol |
| IUPAC name | 2-(2-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | XPFJZGJBRMTXCE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C1=CC=CC=C1Cl)C(=O)O |
Computed by PubChem (NCBI)