cas: 57452-98-9 — see every product listed under this CAS number, including other names
(R)-Praziquantel 99% (CAS 57452-98-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A422918-100mg |
| cas | 57452-98-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 815.38 Pln | |
| Ambeed | 250mg | 1477.31 Pln | |
| Ambeed | 1g | 3869.19 Pln |
| purity | 99% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A422918 |
(11bR)-2-(cyclohexanecarbonyl)-3,6,7,11b-tetrahydro-1H-pyrazino[2,1-a]isoquinolin-4-one (CAS 57452-98-9) is a chemical compound with the molecular formula C19H24N2O2 and a molecular weight of 312.4 g/mol. IUPAC name: (11bR)-2-(cyclohexanecarbonyl)-3,6,7,11b-tetrahydro-1H-pyrazino[2,1-a]isoquinolin-4-one. InChIKey: FSVJFNAIGNNGKK-KRWDZBQOSA-N.
| Molecular formula | C19H24N2O2 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | (11bR)-2-(cyclohexanecarbonyl)-3,6,7,11b-tetrahydro-1H-pyrazino[2,1-a]isoquinolin-4-one |
| InChIKey | FSVJFNAIGNNGKK-KRWDZBQOSA-N |
| SMILES | C1CCC(CC1)C(=O)N2C[C@H]3C4=CC=CC=C4CCN3C(=O)C2 |
Computed by PubChem (NCBI)