Products 1330782-69-8
CAS 1330782-69-8 appears in our catalog under these names: (R)-Simurosertib/ 99.64% (existing batch purity), (R)-Simurosertib, (R)-Simurosertib, 99.58%, (R)-Simurosertib (Standard). Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 2 mg, 5 mg, 10 mg, 50 mg.
2-[(2R)-1-azabicyclo[2.2.2]octan-2-yl]-6-(5-methyl-1H-pyrazol-4-yl)-3H-thieno[3,2-d]pyrimidin-4-one (CAS 1330782-69-8) is a chemical compound with the molecular formula C17H19N5OS and a molecular weight of 341.4 g/mol. IUPAC name: 2-[(2R)-1-azabicyclo[2.2.2]octan-2-yl]-6-(5-methyl-1H-pyrazol-4-yl)-3H-thieno[3,2-d]pyrimidin-4-one. InChIKey: XGVXKJKTISMIOW-CYBMUJFWSA-N.
| Molecular formula | C17H19N5OS |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | 2-[(2R)-1-azabicyclo[2.2.2]octan-2-yl]-6-(5-methyl-1H-pyrazol-4-yl)-3H-thieno[3,2-d]pyrimidin-4-one |
| InChIKey | XGVXKJKTISMIOW-CYBMUJFWSA-N |
| SMILES | CC1=C(C=NN1)C2=CC3=C(S2)C(=O)NC(=N3)[C@H]4CC5CCN4CC5 |
Computed by PubChem (NCBI)