cas: 1359658-32-4 — see every product listed under this CAS number, including other names
(R)-Tert-Butyl 3-(Methoxymethyl)Piperazine-1-Carboxylate, 95%, 95% (CAS 1359658-32-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 25mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110HSF-100mg |
| cas | 1359658-32-4 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 227.60 Pln | |
| Chemat | 250mg | 462.80 Pln | |
| Chemat | 500mg | 707.60 Pln | |
| Chemat | 1g | 1182.80 Pln | |
| Chemat | 5g | 3482.00 Pln | |
| Chemat | 25mg | 160.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (3R)-3-(methoxymethyl)piperazine-1-carboxylate (CAS 1359658-32-4) is a chemical compound with the molecular formula C11H22N2O3 and a molecular weight of 230.30 g/mol. IUPAC name: tert-butyl (3R)-3-(methoxymethyl)piperazine-1-carboxylate. InChIKey: QBJWNCXOPXVECA-SECBINFHSA-N.
| Molecular formula | C11H22N2O3 |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | tert-butyl (3R)-3-(methoxymethyl)piperazine-1-carboxylate |
| InChIKey | QBJWNCXOPXVECA-SECBINFHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN[C@H](C1)COC |
Computed by PubChem (NCBI)