cas: 175844-11-8 — see every product listed under this CAS number, including other names
(R)-methyl 3-bromo-2-((tert-butoxycarbonyl)amino)propanoate, 96% (CAS 175844-11-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F603676-5G |
| cas | 175844-11-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 3423.81 Pln | |
| Fluorochem | 100mg | 351.98 Pln | |
| Fluorochem | 250mg | 409.25 Pln | |
| Fluorochem | 1g | 955.93 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
Methyl (2R)-3-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 175844-11-8) is a chemical compound with the molecular formula C9H16BrNO4 and a molecular weight of 282.13 g/mol. IUPAC name: methyl (2R)-3-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: ODLDPRMMKCMNMD-LURJTMIESA-N.
| Molecular formula | C9H16BrNO4 |
|---|---|
| Molecular weight | 282.13 g/mol |
| IUPAC name | methyl (2R)-3-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | ODLDPRMMKCMNMD-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CBr)C(=O)OC |
Computed by PubChem (NCBI)