cas: 175844-11-8 — see every product listed under this CAS number, including other names
N-Boc-3-bromo-L-alanine Methyl Ester, 96%, 96% (CAS 175844-11-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HZOK-100mg |
| cas | 175844-11-8 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 294.80 Pln | |
| Chemat | 250mg | 342.80 Pln | |
| Chemat | 1g | 837.20 Pln | |
| Chemat | 5g | 2579.60 Pln | |
| Chemat | 10g | 4710.80 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
Methyl (2R)-3-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 175844-11-8) is a chemical compound with the molecular formula C9H16BrNO4 and a molecular weight of 282.13 g/mol. IUPAC name: methyl (2R)-3-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: ODLDPRMMKCMNMD-LURJTMIESA-N.
| Molecular formula | C9H16BrNO4 |
|---|---|
| Molecular weight | 282.13 g/mol |
| IUPAC name | methyl (2R)-3-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | ODLDPRMMKCMNMD-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CBr)C(=O)OC |
Computed by PubChem (NCBI)