cas: 397246-14-9 — see every product listed under this CAS number, including other names
(R)-tert-Butyl (1,4-dihydroxybutan-2-yl)carbamate 97% (CAS 397246-14-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A303296-250mg |
| cas | 397246-14-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 159.00 Pln | |
| Ambeed | 1g | 248.00 Pln | |
| Ambeed | 5g | 654.06 Pln | |
| Ambeed | 25g | 2105.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A303296 |
Tert-butyl N-[(2R)-1,4-dihydroxybutan-2-yl]carbamate (CAS 397246-14-9) is a chemical compound with the molecular formula C9H19NO4 and a molecular weight of 205.25 g/mol. IUPAC name: tert-butyl N-[(2R)-1,4-dihydroxybutan-2-yl]carbamate. InChIKey: KLRRFBSWOIUAHZ-SSDOTTSWSA-N.
| Molecular formula | C9H19NO4 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | tert-butyl N-[(2R)-1,4-dihydroxybutan-2-yl]carbamate |
| InChIKey | KLRRFBSWOIUAHZ-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCO)CO |
Computed by PubChem (NCBI)