cas: 183793-49-9 — see every product listed under this CAS number, including other names
(R)-tert-Butyl (1-hydroxy-3-methoxypropan-2-yl)carbamate 95% (CAS 183793-49-9) is a chemical reagent available from Chemat. Available pack sizes: 100g, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A757534-100g |
| cas | 183793-49-9 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 8113.38 Pln | |
| Ambeed | 1g | 214.62 Pln | |
| Ambeed | 5g | 698.56 Pln | |
| Ambeed | 25g | 2584.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A757534 |
Tert-butyl N-[(2R)-1-hydroxy-3-methoxypropan-2-yl]carbamate (CAS 183793-49-9) is a chemical compound with the molecular formula C9H19NO4 and a molecular weight of 205.25 g/mol. IUPAC name: tert-butyl N-[(2R)-1-hydroxy-3-methoxypropan-2-yl]carbamate. InChIKey: CMWJWKLWQJMPMM-SSDOTTSWSA-N.
| Molecular formula | C9H19NO4 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | tert-butyl N-[(2R)-1-hydroxy-3-methoxypropan-2-yl]carbamate |
| InChIKey | CMWJWKLWQJMPMM-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CO)COC |
Computed by PubChem (NCBI)