cas: 1359658-44-8 — see every product listed under this CAS number, including other names
(R)-tert-Butyl 2-cyanopiperazine-1-carboxylate 97% (CAS 1359658-44-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A419390-100mg |
| cas | 1359658-44-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1037.88 Pln | |
| Ambeed | 250mg | 1621.94 Pln | |
| Ambeed | 1g | 4531.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A419390 |
Tert-butyl (2R)-2-cyanopiperazine-1-carboxylate (CAS 1359658-44-8) is a chemical compound with the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. IUPAC name: tert-butyl (2R)-2-cyanopiperazine-1-carboxylate. InChIKey: YCIUFWZZINYMBA-QMMMGPOBSA-N.
| Molecular formula | C10H17N3O2 |
|---|---|
| Molecular weight | 211.26 g/mol |
| IUPAC name | tert-butyl (2R)-2-cyanopiperazine-1-carboxylate |
| InChIKey | YCIUFWZZINYMBA-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCNC[C@@H]1C#N |
Computed by PubChem (NCBI)