Products 76182-23-5
CAS 76182-23-5 is the registry number for Ethyl 5-amino-1-(tert-butyl)-1h-imidazole-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
Ethyl 5-amino-1-tert-butylimidazole-4-carboxylate (CAS 76182-23-5) is a chemical compound with the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. IUPAC name: ethyl 5-amino-1-tert-butylimidazole-4-carboxylate. InChIKey: UTRRVAPGHIRABU-UHFFFAOYSA-N.
| Molecular formula | C10H17N3O2 |
|---|---|
| Molecular weight | 211.26 g/mol |
| IUPAC name | ethyl 5-amino-1-tert-butylimidazole-4-carboxylate |
| InChIKey | UTRRVAPGHIRABU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(C=N1)C(C)(C)C)N |
Computed by PubChem (NCBI)