cas: 129319-91-1 — see every product listed under this CAS number, including other names
(R)-tert-Butyl 2-methylaziridine-1-carboxylate, 97% (CAS 129319-91-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 25g, 5g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F552210-100MG |
| cas | 129319-91-1 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 112.48 Pln | |
| Fluorochem | 250mg | 154.13 Pln | |
| Fluorochem | 1g | 211.40 Pln | |
| Fluorochem | 25g | 2106.57 Pln | |
| Ambeed | 250mg | 192.38 Pln | |
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 642.94 Pln | |
| Ambeed | 25g | 2072.50 Pln | |
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 395.60 Pln | |
| Chemat | 25g | 1230.80 Pln | |
| BLDpharm | 100mg | 125.54 Pln | |
| BLDpharm | 250mg | 192.18 Pln | |
| BLDpharm | 1g | 225.50 Pln | |
| BLDpharm | 5g | 686.45 Pln | |
| BLDpharm | 25g | 2224.80 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
Tert-butyl (2R)-2-methylaziridine-1-carboxylate (CAS 129319-91-1) is a chemical compound with the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. IUPAC name: tert-butyl (2R)-2-methylaziridine-1-carboxylate. InChIKey: VQLIJOWSVJKBFP-VJSCVCEBSA-N.
| Molecular formula | C8H15NO2 |
|---|---|
| Molecular weight | 157.21 g/mol |
| IUPAC name | tert-butyl (2R)-2-methylaziridine-1-carboxylate |
| InChIKey | VQLIJOWSVJKBFP-VJSCVCEBSA-N |
| SMILES | C[C@@H]1CN1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)