CAS 1254328-22-7 appears in our catalog under these names: Cis-2-methylpiperidine-4-carboxylic acid methyl ester hydrochloride, 95%, cis-Methyl 2-methylpiperidine-4-carboxylate, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
Methyl (2R,4R)-2-methylpiperidine-4-carboxylate (CAS 1254328-22-7) is a chemical compound with the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. IUPAC name: methyl (2R,4R)-2-methylpiperidine-4-carboxylate. InChIKey: LMRCYTXOCDKRRY-RNFRBKRXSA-N.
| Molecular formula | C8H15NO2 |
|---|---|
| Molecular weight | 157.21 g/mol |
| IUPAC name | methyl (2R,4R)-2-methylpiperidine-4-carboxylate |
| InChIKey | LMRCYTXOCDKRRY-RNFRBKRXSA-N |
| SMILES | C[C@@H]1C[C@@H](CCN1)C(=O)OC |
Computed by PubChem (NCBI)