cas: 1354000-03-5 — see every product listed under this CAS number, including other names
(R)-tert-Butyl 3-bromopiperidine-1-carboxylate, 95% (CAS 1354000-03-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 100mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A457918-5g |
| cas | 1354000-03-5 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 9678.76 Pln | |
| AmBeed | 10g | 15160.18 Pln | |
| AmBeed | 100mg | 434.56 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl (3R)-3-bromopiperidine-1-carboxylate (CAS 1354000-03-5) is a chemical compound with the molecular formula C10H18BrNO2 and a molecular weight of 264.16 g/mol. IUPAC name: tert-butyl (3R)-3-bromopiperidine-1-carboxylate. InChIKey: YCUDHDNCZHPAJK-MRVPVSSYSA-N.
| Molecular formula | C10H18BrNO2 |
|---|---|
| Molecular weight | 264.16 g/mol |
| IUPAC name | tert-butyl (3R)-3-bromopiperidine-1-carboxylate |
| InChIKey | YCUDHDNCZHPAJK-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](C1)Br |
Computed by PubChem (NCBI)