CAS 1545706-29-3 appears in our catalog under these names: tert-Butyl ((1-(bromomethyl)cyclopropyl)methyl)carbamate, 97%, tert-Butyl N-{(1-(bromomethyl)cyclopropyl)methyl}carbamate, tert-butyl N-{[1-(bromomethyl)cyclopropyl]methyl}carbamate, 97%, 97%, tert-Butyl N-{[1-(bromomethyl)cyclopropyl]methyl}carbamate, 97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 0,5g, 50mg, 100mg, 250mg, 500mg, 1g.
Tert-butyl N-[[1-(bromomethyl)cyclopropyl]methyl]carbamate (CAS 1545706-29-3) is a chemical compound with the molecular formula C10H18BrNO2 and a molecular weight of 264.16 g/mol. IUPAC name: tert-butyl N-[[1-(bromomethyl)cyclopropyl]methyl]carbamate. InChIKey: XTRAFPXGOUQBGP-UHFFFAOYSA-N.
| Molecular formula | C10H18BrNO2 |
|---|---|
| Molecular weight | 264.16 g/mol |
| IUPAC name | tert-butyl N-[[1-(bromomethyl)cyclopropyl]methyl]carbamate |
| InChIKey | XTRAFPXGOUQBGP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1(CC1)CBr |
Computed by PubChem (NCBI)