cas: 2135284-21-6 — see every product listed under this CAS number, including other names
(R)-tert-Butyl 3-oxo-2-phenylpiperazine-1-carboxylate, 95% (CAS 2135284-21-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F547698-100MG |
| cas | 2135284-21-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1070.47 Pln | |
| Fluorochem | 250mg | 1762.94 Pln | |
| Fluorochem | 1g | 4642.13 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (2R)-3-oxo-2-phenylpiperazine-1-carboxylate (CAS 2135284-21-6) is a chemical compound with the molecular formula C15H20N2O3 and a molecular weight of 276.33 g/mol. IUPAC name: tert-butyl (2R)-3-oxo-2-phenylpiperazine-1-carboxylate. InChIKey: XWYOGPGTTFWZAP-GFCCVEGCSA-N.
| Molecular formula | C15H20N2O3 |
|---|---|
| Molecular weight | 276.33 g/mol |
| IUPAC name | tert-butyl (2R)-3-oxo-2-phenylpiperazine-1-carboxylate |
| InChIKey | XWYOGPGTTFWZAP-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCNC(=O)[C@H]1C2=CC=CC=C2 |
Computed by PubChem (NCBI)