CAS 1049677-44-2 appears in our catalog under these names: 1-Boc-6-amino-3,3-dimethyl-2-oxo-2,3-dihydro-indole, 95%, 1-Boc-6-Amino-3,3-dimethyl-2-oxo-2,3-dihydroindole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
Tert-butyl 6-amino-3,3-dimethyl-2-oxoindole-1-carboxylate (CAS 1049677-44-2) is a chemical compound with the molecular formula C15H20N2O3 and a molecular weight of 276.33 g/mol. IUPAC name: tert-butyl 6-amino-3,3-dimethyl-2-oxoindole-1-carboxylate. InChIKey: UJIRYDBKWMIYJE-UHFFFAOYSA-N.
| Molecular formula | C15H20N2O3 |
|---|---|
| Molecular weight | 276.33 g/mol |
| IUPAC name | tert-butyl 6-amino-3,3-dimethyl-2-oxoindole-1-carboxylate |
| InChIKey | UJIRYDBKWMIYJE-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=C(C=C2)N)N(C1=O)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)