(R,E)-4-Phenylbut-3-en-2-ol, 95%
cas: 62413-47-2 — see every product listed under this CAS number, including other names
(R,E)-4-Phenylbut-3-en-2-ol, 95% (CAS 62413-47-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A980004-100mg |
| cas | 62413-47-2 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1160.25 Pln | |
| Ambeed | 250mg | 1939.00 Pln | |
| Ambeed | 1g | 5359.94 Pln | |
| BLDpharm | 50mg | 819.74 Pln | |
| BLDpharm | 100mg | 1247.36 Pln | |
| BLDpharm | 250mg | 2085.96 Pln | |
| BLDpharm | 1g | 5773.55 Pln | |
| Chemat | 100mg | 851.60 Pln | |
| Chemat | 250mg | 1418.00 Pln | |
| Chemat | 1g | 3909.20 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
(E,2R)-4-phenylbut-3-en-2-ol (CAS 62413-47-2) is a chemical compound with the molecular formula C10H12O and a molecular weight of 148.20 g/mol. IUPAC name: (E,2R)-4-phenylbut-3-en-2-ol. InChIKey: ZIJWGEHOVHJHKB-FCZSHJHJSA-N.
| Molecular formula | C10H12O |
|---|---|
| Molecular weight | 148.20 g/mol |
| IUPAC name | (E,2R)-4-phenylbut-3-en-2-ol |
| InChIKey | ZIJWGEHOVHJHKB-FCZSHJHJSA-N |
| SMILES | C[C@H](/C=C/C1=CC=CC=C1)O |
Computed by PubChem (NCBI)