CAS 32271-52-6 is the registry number for (R)-4-Phenylbut-3-en-2-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(E,2R)-4-phenylbut-3-en-2-ol (CAS 32271-52-6) is a chemical compound with the molecular formula C10H12O and a molecular weight of 148.20 g/mol. IUPAC name: (E,2R)-4-phenylbut-3-en-2-ol. InChIKey: ZIJWGEHOVHJHKB-FCZSHJHJSA-N.
| Molecular formula | C10H12O |
|---|---|
| Molecular weight | 148.20 g/mol |
| IUPAC name | (E,2R)-4-phenylbut-3-en-2-ol |
| InChIKey | ZIJWGEHOVHJHKB-FCZSHJHJSA-N |
| SMILES | C[C@H](/C=C/C1=CC=CC=C1)O |
Computed by PubChem (NCBI)