Products 2143100-98-3
CAS 2143100-98-3 is the registry number for (Rac)-Aurora A/PKC-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[6-(selenolan-3-ylamino)-7H-purin-2-yl]-1,2-benzoselenazol-3-one (CAS 2143100-98-3) is a chemical compound with the molecular formula C16H14N6OSe2 and a molecular weight of 464.3 g/mol. IUPAC name: 2-[6-(selenolan-3-ylamino)-7H-purin-2-yl]-1,2-benzoselenazol-3-one. InChIKey: JKTIMGKTTJTCFS-UHFFFAOYSA-N.
| Molecular formula | C16H14N6OSe2 |
|---|---|
| Molecular weight | 464.3 g/mol |
| IUPAC name | 2-[6-(selenolan-3-ylamino)-7H-purin-2-yl]-1,2-benzoselenazol-3-one |
| InChIKey | JKTIMGKTTJTCFS-UHFFFAOYSA-N |
| SMILES | C1C[Se]CC1NC2=NC(=NC3=C2NC=N3)N4C(=O)C5=CC=CC=C5[Se]4 |
Computed by PubChem (NCBI)