cas: 925240-97-7 — see every product listed under this CAS number, including other names
(S)–2–((((9H–Fluoren–9–yl)methoxy)carbonyl)(methyl)amino)–2–cyclohexylacetic acid (CAS 925240-97-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GB51678-100 |
| cas | 925240-97-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 770.22 Pln | |
| GLPBio | 1g | 1926.30 Pln | |
| GLPBio | 250mg | 1018.28 Pln | |
| GLPBio | 5g | 5104.36 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(2S)-2-cyclohexyl-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]acetic acid (CAS 925240-97-7) is a chemical compound with the molecular formula C24H27NO4 and a molecular weight of 393.5 g/mol. IUPAC name: (2S)-2-cyclohexyl-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]acetic acid. InChIKey: ZVTSJEYBSAOGMV-QFIPXVFZSA-N.
| Molecular formula | C24H27NO4 |
|---|---|
| Molecular weight | 393.5 g/mol |
| IUPAC name | (2S)-2-cyclohexyl-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]acetic acid |
| InChIKey | ZVTSJEYBSAOGMV-QFIPXVFZSA-N |
| SMILES | CN([C@@H](C1CCCCC1)C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)