cas: 64030-44-0 — see every product listed under this CAS number, including other names
(S)–N–(Pyrrolidin–2–ylmethyl)aniline (CAS 64030-44-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GB52133-100 |
| cas | 64030-44-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 517.47 Pln | |
| GLPBio | 1g | 915.31 Pln | |
| GLPBio | 250mg | 564.28 Pln | |
| GLPBio | 5g | 2169.69 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
N-[[(2S)-pyrrolidin-2-yl]methyl]aniline (CAS 64030-44-0) is a chemical compound with the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. IUPAC name: N-[[(2S)-pyrrolidin-2-yl]methyl]aniline. InChIKey: MCHWKJRTMPIHRA-NSHDSACASA-N.
| Molecular formula | C11H16N2 |
|---|---|
| Molecular weight | 176.26 g/mol |
| IUPAC name | N-[[(2S)-pyrrolidin-2-yl]methyl]aniline |
| InChIKey | MCHWKJRTMPIHRA-NSHDSACASA-N |
| SMILES | C1C[C@H](NC1)CNC2=CC=CC=C2 |
Computed by PubChem (NCBI)