CAS 68295-45-4 appears in our catalog under these names: (R)-(-)-2-(Anilinomethyl)pyrrolidine, 95%, (R)-N-(Pyrrolidin-2-ylmethyl)aniline, 97+%, (R)–(–)–2–(Anilinomethyl)pyrrolidine. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g.
N-[[(2R)-pyrrolidin-2-yl]methyl]aniline (CAS 68295-45-4) is a chemical compound with the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. IUPAC name: N-[[(2R)-pyrrolidin-2-yl]methyl]aniline. InChIKey: MCHWKJRTMPIHRA-LLVKDONJSA-N.
| Molecular formula | C11H16N2 |
|---|---|
| Molecular weight | 176.26 g/mol |
| IUPAC name | N-[[(2R)-pyrrolidin-2-yl]methyl]aniline |
| InChIKey | MCHWKJRTMPIHRA-LLVKDONJSA-N |
| SMILES | C1C[C@@H](NC1)CNC2=CC=CC=C2 |
Computed by PubChem (NCBI)