cas: 848821-58-9 — see every product listed under this CAS number, including other names
(S)-(-)-alpha,alpha-Diphenyl-2-pyrrolidinemethanol Trimethylsilyl Ether, >98.0%(GC)(T) (CAS 848821-58-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D3843-1G |
| cas | 848821-58-9 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 644.49 Pln | |
| TCI | 5g | 2468.79 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
[diphenyl-[(2S)-pyrrolidin-2-yl]methoxy]-trimethylsilane (CAS 848821-58-9) is a chemical compound with the molecular formula C20H27NOSi and a molecular weight of 325.5 g/mol. IUPAC name: [diphenyl-[(2S)-pyrrolidin-2-yl]methoxy]-trimethylsilane. InChIKey: RSUHWMSTWSSNOW-IBGZPJMESA-N.
| Molecular formula | C20H27NOSi |
|---|---|
| Molecular weight | 325.5 g/mol |
| IUPAC name | [diphenyl-[(2S)-pyrrolidin-2-yl]methoxy]-trimethylsilane |
| InChIKey | RSUHWMSTWSSNOW-IBGZPJMESA-N |
| SMILES | C[Si](C)(C)OC([C@@H]1CCCN1)(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)