CAS 802909-18-8 appears in our catalog under these names: 9-(tert-Butyldimethylsilyl)oxymethyl-2-aminofluorene, 95%, 9-(((tert-Butyldimethylsilyl)oxy)methyl)-9H-fluoren-2-amine, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g.
9-[[tert-butyl(dimethyl)silyl]oxymethyl]-9H-fluoren-2-amine (CAS 802909-18-8) is a chemical compound with the molecular formula C20H27NOSi and a molecular weight of 325.5 g/mol. IUPAC name: 9-[[tert-butyl(dimethyl)silyl]oxymethyl]-9H-fluoren-2-amine. InChIKey: NUKGMRZJRUHHMM-UHFFFAOYSA-N.
| Molecular formula | C20H27NOSi |
|---|---|
| Molecular weight | 325.5 g/mol |
| IUPAC name | 9-[[tert-butyl(dimethyl)silyl]oxymethyl]-9H-fluoren-2-amine |
| InChIKey | NUKGMRZJRUHHMM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC1C2=CC=CC=C2C3=C1C=C(C=C3)N |
Computed by PubChem (NCBI)