cas: 18881-17-9 — see every product listed under this CAS number, including other names
(S)-(1,2,3,4-Tetrahydroisoquinolin-3-yl)methanol, 97%, 97% (CAS 18881-17-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113HCX-1g |
| cas | 18881-17-9 |
| size | 1g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 155.60 Pln | |
| Chemat | 10g | 251.60 Pln | |
| Chemat | 25g | 530.00 Pln | |
| Chemat | 100g | 1931.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]methanol (CAS 18881-17-9) is a chemical compound with the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. IUPAC name: [(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]methanol. InChIKey: ZSKDXMLMMQFHGW-JTQLQIEISA-N.
| Molecular formula | C10H13NO |
|---|---|
| Molecular weight | 163.22 g/mol |
| IUPAC name | [(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]methanol |
| InChIKey | ZSKDXMLMMQFHGW-JTQLQIEISA-N |
| SMILES | C1[C@H](NCC2=CC=CC=C21)CO |
Computed by PubChem (NCBI)